C14H29N3O4 — CID 143194126
cis-(1R,3S)-cyclopentane-1,3-diamine;4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (PubChem CID 143194126) has the molecular formula C14H29N3O4 and a molecular weight of 303.40 g/mol. Its IUPAC name is cis-(1R,3S)-cyclopentane-1,3-diamine;4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid.
| Compound Name | cis-(1R,3S)-cyclopentane-1,3-diamine;4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
|---|---|
| PubChem CID | 143194126 |
| Molecular Formula | C14H29N3O4 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | cis-(1R,3S)-cyclopentane-1,3-diamine;4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)O.N[C@@H]1CC[C@H](N)C1 |
| InChI | InChI=1S/C9H17NO4.C5H12N2/c1-9(2,3)14-8(13)10-6-4-5-7(11)12;6-4-1-2-5(7)3-4/h4-6H2,1-3H3,(H,10,13)(H,11,12);4-5H,1-3,6-7H2/t;4-,5+ |
| InChIKey | KFIKQHRGTWTNDU-OVVSMXPMSA-N |
| XLogP | 1.20 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|