C21H40N2O4 — CID 131863507
N-cyclohexylcyclohexanamine;4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (PubChem CID 131863507) has the molecular formula C21H40N2O4 and a molecular weight of 384.56 g/mol. Its IUPAC name is N-cyclohexylcyclohexanamine;4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid.
| Compound Name | N-cyclohexylcyclohexanamine;4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
|---|---|
| PubChem CID | 131863507 |
| Molecular Formula | C21H40N2O4 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | N-cyclohexylcyclohexanamine;4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| SMILES | C1CCC(NC2CCCCC2)CC1.CC(C)(C)OC(=O)NCCCC(=O)O |
| InChI | InChI=1S/C12H23N.C9H17NO4/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-9(2,3)14-8(13)10-6-4-5-7(11)12/h11-13H,1-10H2;4-6H2,1-3H3,(H,10,13)(H,11,12) |
| InChIKey | WUMNVMQSRPVEAE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|