C20H38N2O4 — CID 2828510
N-cyclohexylcyclohexanamine;2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 2828510) has the molecular formula C20H38N2O4 and a molecular weight of 370.53 g/mol. Its IUPAC name is N-cyclohexylcyclohexanamine;2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | N-cyclohexylcyclohexanamine;2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 2828510 |
| Molecular Formula | C20H38N2O4 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.28 |
| IUPAC Name | N-cyclohexylcyclohexanamine;2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | C1CCC(NC2CCCCC2)CC1.CC(NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C12H23N.C8H15NO4/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-5(6(10)11)9-7(12)13-8(2,3)4/h11-13H,1-10H2;5H,1-4H3,(H,9,12)(H,10,11) |
| InChIKey | KTGJIYLTQWUHFQ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |