C21H38N2O6 — CID 138109289
N-cyclohexylcyclohexanamine;2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioic acid (PubChem CID 138109289) has the molecular formula C21H38N2O6 and a molecular weight of 414.54 g/mol. Its IUPAC name is N-cyclohexylcyclohexanamine;2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioic acid.
| Compound Name | N-cyclohexylcyclohexanamine;2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioic acid |
|---|---|
| PubChem CID | 138109289 |
| Molecular Formula | C21H38N2O6 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.27 |
| IUPAC Name | N-cyclohexylcyclohexanamine;2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioic acid |
| SMILES | C1CCC(NC2CCCCC2)CC1.CC(C)(C)OC(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H23N.C9H15NO6/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-9(2,3)16-8(15)10-5(7(13)14)4-6(11)12/h11-13H,1-10H2;5H,4H2,1-3H3,(H,10,15)(H,11,12)(H,13,14) |
| InChIKey | KPGMIUOCJHZIMK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |