C14H27NO2 — CID 164901187
(1-deuterio-2-methylpropan-2-yl) N-(3-cyclohexylpropyl)carbamate (PubChem CID 164901187) has the molecular formula C14H27NO2 and a molecular weight of 242.38 g/mol. Its IUPAC name is (1-deuterio-2-methylpropan-2-yl) N-(3-cyclohexylpropyl)carbamate.
| Compound Name | (1-deuterio-2-methylpropan-2-yl) N-(3-cyclohexylpropyl)carbamate |
|---|---|
| PubChem CID | 164901187 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 242.38 g/mol |
| Exact Mass | 242.21 |
| IUPAC Name | (1-deuterio-2-methylpropan-2-yl) N-(3-cyclohexylpropyl)carbamate |
| SMILES | [2H]CC(C)(C)OC(=O)NCCCC1CCCCC1 |
| InChI | InChI=1S/C14H27NO2/c1-14(2,3)17-13(16)15-11-7-10-12-8-5-4-6-9-12/h12H,4-11H2,1-3H3,(H,15,16)/i1D |
| InChIKey | PJMCXDZWTLZOII-MICDWDOJSA-N |
| XLogP | 3.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|