C15H30N2O2 — CID 83982209
tert-butyl N-[3-(1-ethylpiperidin-2-yl)propyl]carbamate (PubChem CID 83982209) has the molecular formula C15H30N2O2 and a molecular weight of 270.42 g/mol. Its IUPAC name is tert-butyl N-[3-(1-ethylpiperidin-2-yl)propyl]carbamate.
| Compound Name | tert-butyl N-[3-(1-ethylpiperidin-2-yl)propyl]carbamate |
|---|---|
| PubChem CID | 83982209 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | tert-butyl N-[3-(1-ethylpiperidin-2-yl)propyl]carbamate |
| SMILES | CCN1CCCCC1CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H30N2O2/c1-5-17-12-7-6-9-13(17)10-8-11-16-14(18)19-15(2,3)4/h13H,5-12H2,1-4H3,(H,16,18) |
| InChIKey | RHSNBWPFFYKEOQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|