C14H27N3O3 — CID 54459116
tert-butyl N-[4-[(2S)-2-carbamoylpyrrolidin-1-yl]butyl]carbamate (PubChem CID 54459116) has the molecular formula C14H27N3O3 and a molecular weight of 285.39 g/mol. Its IUPAC name is tert-butyl N-[4-[(2S)-2-carbamoylpyrrolidin-1-yl]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[(2S)-2-carbamoylpyrrolidin-1-yl]butyl]carbamate |
|---|---|
| PubChem CID | 54459116 |
| Molecular Formula | C14H27N3O3 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | tert-butyl N-[4-[(2S)-2-carbamoylpyrrolidin-1-yl]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCN1CCC[C@H]1C(N)=O |
| InChI | InChI=1S/C14H27N3O3/c1-14(2,3)20-13(19)16-8-4-5-9-17-10-6-7-11(17)12(15)18/h11H,4-10H2,1-3H3,(H2,15,18)(H,16,19)/t11-/m0/s1 |
| InChIKey | XAIPOVCOHAUUHO-NSHDSACASA-N |
| XLogP | 1.24 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|