C15H25N3O4 — CID 160509958
(2S)-1-[4,5-dioxo-5-(4-oxopentylamino)pentyl]pyrrolidine-2-carboxamide (PubChem CID 160509958) has the molecular formula C15H25N3O4 and a molecular weight of 311.38 g/mol. Its IUPAC name is (2S)-1-[4,5-dioxo-5-(4-oxopentylamino)pentyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[4,5-dioxo-5-(4-oxopentylamino)pentyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 160509958 |
| Molecular Formula | C15H25N3O4 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | (2S)-1-[4,5-dioxo-5-(4-oxopentylamino)pentyl]pyrrolidine-2-carboxamide |
| SMILES | CC(=O)CCCNC(=O)C(=O)CCCN1CCC[C@H]1C(N)=O |
| InChI | InChI=1S/C15H25N3O4/c1-11(19)5-2-8-17-15(22)13(20)7-4-10-18-9-3-6-12(18)14(16)21/h12H,2-10H2,1H3,(H2,16,21)(H,17,22)/t12-/m0/s1 |
| InChIKey | JCEOUFJMJBCBLF-LBPRGKRZSA-N |
| XLogP | -0.23 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|