C13H18N2O5 — CID 138612692
2-[1-[3-(2,3-dioxopropanoylamino)propyl]pyrrolidin-2-yl]prop-2-enoic acid (PubChem CID 138612692) has the molecular formula C13H18N2O5 and a molecular weight of 282.30 g/mol. Its IUPAC name is 2-[1-[3-(2,3-dioxopropanoylamino)propyl]pyrrolidin-2-yl]prop-2-enoic acid.
| Compound Name | 2-[1-[3-(2,3-dioxopropanoylamino)propyl]pyrrolidin-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 138612692 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 2-[1-[3-(2,3-dioxopropanoylamino)propyl]pyrrolidin-2-yl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)C1CCCN1CCCNC(=O)C(=O)C=O |
| InChI | InChI=1S/C13H18N2O5/c1-9(13(19)20)10-4-2-6-15(10)7-3-5-14-12(18)11(17)8-16/h8,10H,1-7H2,(H,14,18)(H,19,20) |
| InChIKey | OPSRISHDHOARDF-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|