C14H26N2O5 — CID 175604221
(2S)-1-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethyl]pyrrolidine-2-carboxylic acid (PubChem CID 175604221) has the molecular formula C14H26N2O5 and a molecular weight of 302.37 g/mol. Its IUPAC name is (2S)-1-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 175604221 |
| Molecular Formula | C14H26N2O5 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | (2S)-1-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)NCCOCCN1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C14H26N2O5/c1-14(2,3)21-13(19)15-6-9-20-10-8-16-7-4-5-11(16)12(17)18/h11H,4-10H2,1-3H3,(H,15,19)(H,17,18)/t11-/m0/s1 |
| InChIKey | CBESJNHOYGKZPX-NSHDSACASA-N |
| XLogP | 1.08 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|