C18H33NO6 — CID 123999633
2-hydroxyethyl [2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]cycloheptyl] carbonate (PubChem CID 123999633) has the molecular formula C18H33NO6 and a molecular weight of 359.46 g/mol. Its IUPAC name is 2-hydroxyethyl [2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]cycloheptyl] carbonate.
| Compound Name | 2-hydroxyethyl [2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]cycloheptyl] carbonate |
|---|---|
| PubChem CID | 123999633 |
| Molecular Formula | C18H33NO6 |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | 2-hydroxyethyl [2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]cycloheptyl] carbonate |
| SMILES | CC(C)(C)OC(=O)NCCCC1CCCCCC1OC(=O)OCCO |
| InChI | InChI=1S/C18H33NO6/c1-18(2,3)25-16(21)19-11-7-9-14-8-5-4-6-10-15(14)24-17(22)23-13-12-20/h14-15,20H,4-13H2,1-3H3,(H,19,21) |
| InChIKey | GLZBPZQLNKUYQH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|