C26H50N2O6 — CID 142616129
tert-butyl N-[5-[2-[2-[5-(cyclohexanecarbonylamino)pentoxy]ethoxy]ethoxy]pentyl]carbamate (PubChem CID 142616129) has the molecular formula C26H50N2O6 and a molecular weight of 486.69 g/mol. Its IUPAC name is tert-butyl N-[5-[2-[2-[5-(cyclohexanecarbonylamino)pentoxy]ethoxy]ethoxy]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-[2-[2-[5-(cyclohexanecarbonylamino)pentoxy]ethoxy]ethoxy]pentyl]carbamate |
|---|---|
| PubChem CID | 142616129 |
| Molecular Formula | C26H50N2O6 |
| Molecular Weight | 486.69 g/mol |
| Exact Mass | 486.37 |
| IUPAC Name | tert-butyl N-[5-[2-[2-[5-(cyclohexanecarbonylamino)pentoxy]ethoxy]ethoxy]pentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCOCCOCCOCCCCCNC(=O)C1CCCCC1 |
| InChI | InChI=1S/C26H50N2O6/c1-26(2,3)34-25(30)28-16-10-6-12-18-32-20-22-33-21-19-31-17-11-5-9-15-27-24(29)23-13-7-4-8-14-23/h23H,4-22H2,1-3H3,(H,27,29)(H,28,30) |
| InChIKey | SUXYJILOPIZZJR-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.69 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|