C42H78N6O15 — CID 23626027
tert-butyl N-[2-[2-[2-[[3,5-bis[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethylcarbamoyl]cyclohexanecarbonyl]amino]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 23626027) has the molecular formula C42H78N6O15 and a molecular weight of 907.11 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[[3,5-bis[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethylcarbamoyl]cyclohexanecarbonyl]amino]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[[3,5-bis[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethylcarbamoyl]cyclohexanecarbonyl]amino]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 23626027 |
| Molecular Formula | C42H78N6O15 |
| Molecular Weight | 907.11 g/mol |
| Exact Mass | 906.55 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[[3,5-bis[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethylcarbamoyl]cyclohexanecarbonyl]amino]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCNC(=O)C1CC(C(=O)NCCOCCOCCNC(=O)OC(C)(C)C)CC(C(=O)NCCOCCOCCNC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C42H78N6O15/c1-40(2,3)61-37(52)46-13-19-58-25-22-55-16-10-43-34(49)31-28-32(35(50)44-11-17-56-23-26-59-20-14-47-38(53)62-41(4,5)6)30-33(29-31)36(51)45-12-18-57-24-27-60-21-15-48-39(54)63-42(7,8)9/h31-33H,10-30H2,1-9H3,(H,43,49)(H,44,50)(H,45,51)(H,46,52)(H,47,53)(H,48,54) |
| InChIKey | SVHBAYHQOLUYFM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 257.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.11 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|