C14H30N2O4 — CID 135203827
2-(aminomethyl)cyclohexan-1-ol;tert-butyl N-(2-hydroxyethyl)carbamate (PubChem CID 135203827) has the molecular formula C14H30N2O4 and a molecular weight of 290.40 g/mol. Its IUPAC name is 2-(aminomethyl)cyclohexan-1-ol;tert-butyl N-(2-hydroxyethyl)carbamate.
| Compound Name | 2-(aminomethyl)cyclohexan-1-ol;tert-butyl N-(2-hydroxyethyl)carbamate |
|---|---|
| PubChem CID | 135203827 |
| Molecular Formula | C14H30N2O4 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 2-(aminomethyl)cyclohexan-1-ol;tert-butyl N-(2-hydroxyethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NCCO.NCC1CCCCC1O |
| InChI | InChI=1S/C7H15NO3.C7H15NO/c1-7(2,3)11-6(10)8-4-5-9;8-5-6-3-1-2-4-7(6)9/h9H,4-5H2,1-3H3,(H,8,10);6-7,9H,1-5,8H2 |
| InChIKey | QCWMACRQVVTOAL-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |