C16H29NO3 — CID 76712693
tert-butyl N-[3-(2-ethenoxycyclohexyl)propyl]carbamate (PubChem CID 76712693) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is tert-butyl N-[3-(2-ethenoxycyclohexyl)propyl]carbamate.
| Compound Name | tert-butyl N-[3-(2-ethenoxycyclohexyl)propyl]carbamate |
|---|---|
| PubChem CID | 76712693 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | tert-butyl N-[3-(2-ethenoxycyclohexyl)propyl]carbamate |
| SMILES | C=COC1CCCCC1CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H29NO3/c1-5-19-14-11-7-6-9-13(14)10-8-12-17-15(18)20-16(2,3)4/h5,13-14H,1,6-12H2,2-4H3,(H,17,18) |
| InChIKey | JYKKMAZFBZYOFR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|