C18H37N3O2 — CID 177068003
tert-butyl N-[7-[(4-aminocyclohexyl)amino]heptyl]carbamate (PubChem CID 177068003) has the molecular formula C18H37N3O2 and a molecular weight of 327.51 g/mol. Its IUPAC name is tert-butyl N-[7-[(4-aminocyclohexyl)amino]heptyl]carbamate.
| Compound Name | tert-butyl N-[7-[(4-aminocyclohexyl)amino]heptyl]carbamate |
|---|---|
| PubChem CID | 177068003 |
| Molecular Formula | C18H37N3O2 |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.29 |
| IUPAC Name | tert-butyl N-[7-[(4-aminocyclohexyl)amino]heptyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCCCNC1CCC(N)CC1 |
| InChI | InChI=1S/C18H37N3O2/c1-18(2,3)23-17(22)21-14-8-6-4-5-7-13-20-16-11-9-15(19)10-12-16/h15-16,20H,4-14,19H2,1-3H3,(H,21,22) |
| InChIKey | CSRUNQCCHYAGQB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|