C15H30N4O3 — CID 103821865
tert-butyl N-[3-[[1-(2-amino-2-oxoethyl)piperidin-4-yl]amino]propyl]carbamate (PubChem CID 103821865) has the molecular formula C15H30N4O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is tert-butyl N-[3-[[1-(2-amino-2-oxoethyl)piperidin-4-yl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[1-(2-amino-2-oxoethyl)piperidin-4-yl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 103821865 |
| Molecular Formula | C15H30N4O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | tert-butyl N-[3-[[1-(2-amino-2-oxoethyl)piperidin-4-yl]amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNC1CCN(CC(N)=O)CC1 |
| InChI | InChI=1S/C15H30N4O3/c1-15(2,3)22-14(21)18-8-4-7-17-12-5-9-19(10-6-12)11-13(16)20/h12,17H,4-11H2,1-3H3,(H2,16,20)(H,18,21) |
| InChIKey | NENRZCKWHALAOB-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|