C15H24N2O2 — CID 142539752
[(2E)-2-ethenylpenta-2,4-dienyl] N-(2-piperidin-4-ylethyl)carbamate (PubChem CID 142539752) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is [(2E)-2-ethenylpenta-2,4-dienyl] N-(2-piperidin-4-ylethyl)carbamate.
| Compound Name | [(2E)-2-ethenylpenta-2,4-dienyl] N-(2-piperidin-4-ylethyl)carbamate |
|---|---|
| PubChem CID | 142539752 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | [(2E)-2-ethenylpenta-2,4-dienyl] N-(2-piperidin-4-ylethyl)carbamate |
| SMILES | C=C/C=C(\C=C)COC(=O)NCCC1CCNCC1 |
| InChI | InChI=1S/C15H24N2O2/c1-3-5-13(4-2)12-19-15(18)17-11-8-14-6-9-16-10-7-14/h3-5,14,16H,1-2,6-12H2,(H,17,18)/b13-5+ |
| InChIKey | VOEQQMLYFGZEON-WLRTZDKTSA-N |
| XLogP | 2.40 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|