C14H22N2O2 — CID 143271982
[(2E)-2-ethenylpenta-2,4-dienyl] N-methyl-N-piperidin-4-ylcarbamate (PubChem CID 143271982) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is [(2E)-2-ethenylpenta-2,4-dienyl] N-methyl-N-piperidin-4-ylcarbamate.
| Compound Name | [(2E)-2-ethenylpenta-2,4-dienyl] N-methyl-N-piperidin-4-ylcarbamate |
|---|---|
| PubChem CID | 143271982 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | [(2E)-2-ethenylpenta-2,4-dienyl] N-methyl-N-piperidin-4-ylcarbamate |
| SMILES | C=C/C=C(\C=C)COC(=O)N(C)C1CCNCC1 |
| InChI | InChI=1S/C14H22N2O2/c1-4-6-12(5-2)11-18-14(17)16(3)13-7-9-15-10-8-13/h4-6,13,15H,1-2,7-11H2,3H3/b12-6+ |
| InChIKey | FZTCGDLJVGJJCE-WUXMJOGZSA-N |
| XLogP | 2.11 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|