C16H26N2O2 — CID 143632095
[(2E)-2-ethenylpenta-2,4-dienyl] 4-(dimethylamino)azepane-1-carboxylate (PubChem CID 143632095) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is [(2E)-2-ethenylpenta-2,4-dienyl] 4-(dimethylamino)azepane-1-carboxylate.
| Compound Name | [(2E)-2-ethenylpenta-2,4-dienyl] 4-(dimethylamino)azepane-1-carboxylate |
|---|---|
| PubChem CID | 143632095 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | [(2E)-2-ethenylpenta-2,4-dienyl] 4-(dimethylamino)azepane-1-carboxylate |
| SMILES | C=C/C=C(\C=C)COC(=O)N1CCCC(N(C)C)CC1 |
| InChI | InChI=1S/C16H26N2O2/c1-5-8-14(6-2)13-20-16(19)18-11-7-9-15(10-12-18)17(3)4/h5-6,8,15H,1-2,7,9-13H2,3-4H3/b14-8+ |
| InChIKey | SLOKZJHGSJKIFB-RIYZIHGNSA-N |
| XLogP | 2.84 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|