C14H20INO2 — CID 142532081
2-[(2E)-2-ethenylpenta-2,4-dienoxy]-1-(3-iodopiperidin-1-yl)ethanone (PubChem CID 142532081) has the molecular formula C14H20INO2 and a molecular weight of 361.22 g/mol. Its IUPAC name is 2-[(2E)-2-ethenylpenta-2,4-dienoxy]-1-(3-iodopiperidin-1-yl)ethanone.
| Compound Name | 2-[(2E)-2-ethenylpenta-2,4-dienoxy]-1-(3-iodopiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 142532081 |
| Molecular Formula | C14H20INO2 |
| Molecular Weight | 361.22 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 2-[(2E)-2-ethenylpenta-2,4-dienoxy]-1-(3-iodopiperidin-1-yl)ethanone |
| SMILES | C=C/C=C(\C=C)COCC(=O)N1CCCC(I)C1 |
| InChI | InChI=1S/C14H20INO2/c1-3-6-12(4-2)10-18-11-14(17)16-8-5-7-13(15)9-16/h3-4,6,13H,1-2,5,7-11H2/b12-6+ |
| InChIKey | MRRYSKKQUYRKAT-WUXMJOGZSA-N |
| XLogP | 2.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.22 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|