About [(2E)-2-ethenylpenta-2,4-dienyl] 3-hydroxypyrrolidine-1-carboxylate
[(2E)-2-ethenylpenta-2,4-dienyl] 3-hydroxypyrrolidine-1-carboxylate (PubChem CID 178029392) has the molecular formula C12H17NO3
and a molecular weight of 223.27 g/mol. Its IUPAC name is [(2E)-2-ethenylpenta-2,4-dienyl] 3-hydroxypyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | [(2E)-2-ethenylpenta-2,4-dienyl] 3-hydroxypyrrolidine-1-carboxylate |
| PubChem CID | 178029392 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | [(2E)-2-ethenylpenta-2,4-dienyl] 3-hydroxypyrrolidine-1-carboxylate |
| SMILES | C=C/C=C(\C=C)COC(=O)N1CCC(O)C1 |
| InChI | InChI=1S/C12H17NO3/c1-3-5-10(4-2)9-16-12(15)13-7-6-11(14)8-13/h3-5,11,14H,1-2,6-9H2/b10-5+ |
| InChIKey | UTDUOPSYTNEPQK-BJMVGYQFSA-N |
| XLogP | 1.49 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(2E)-2-ethenylpenta-2,4-dienyl] 3-hydroxypyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2E)-2-ethenylpenta-2,4-dienyl] 3-hydroxypyrrolidine-1-carboxylate?
The IUPAC name of [(2E)-2-ethenylpenta-2,4-dienyl] 3-hydroxypyrrolidine-1-carboxylate (CID 178029392) is [(2E)-2-ethenylpenta-2,4-dienyl] 3-hydroxypyrrolidine-1-carboxylate.
What is the SMILES notation for [(2E)-2-ethenylpenta-2,4-dienyl] 3-hydroxypyrrolidine-1-carboxylate?
The canonical SMILES for [(2E)-2-ethenylpenta-2,4-dienyl] 3-hydroxypyrrolidine-1-carboxylate is C=C/C=C(\C=C)COC(=O)N1CCC(O)C1.
What is the InChIKey of [(2E)-2-ethenylpenta-2,4-dienyl] 3-hydroxypyrrolidine-1-carboxylate?
The InChIKey is UTDUOPSYTNEPQK-BJMVGYQFSA-N. The full InChI is InChI=1S/C12H17NO3/c1-3-5-10(4-2)9-16-12(15)13-7-6-11(14)8-13/h3-5,11,14H,1-2,6-9H2/b10-5+.
What are the key properties of [(2E)-2-ethenylpenta-2,4-dienyl] 3-hydroxypyrrolidine-1-carboxylate?
[(2E)-2-ethenylpenta-2,4-dienyl] 3-hydroxypyrrolidine-1-carboxylate has a molecular weight of 223.27 g/mol, XLogP of 1.49, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2E)-2-ethenylpenta-2,4-dienyl] 3-hydroxypyrrolidine-1-carboxylate is sourced from PubChem (CID 178029392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).