C12H16N2O3 — CID 142041099
[(2E)-2-ethenylpenta-2,4-dienyl] 3-oxopiperazine-1-carboxylate (PubChem CID 142041099) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is [(2E)-2-ethenylpenta-2,4-dienyl] 3-oxopiperazine-1-carboxylate.
| Compound Name | [(2E)-2-ethenylpenta-2,4-dienyl] 3-oxopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 142041099 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | [(2E)-2-ethenylpenta-2,4-dienyl] 3-oxopiperazine-1-carboxylate |
| SMILES | C=C/C=C(\C=C)COC(=O)N1CCNC(=O)C1 |
| InChI | InChI=1S/C12H16N2O3/c1-3-5-10(4-2)9-17-12(16)14-7-6-13-11(15)8-14/h3-5H,1-2,6-9H2,(H,13,15)/b10-5+ |
| InChIKey | MFKXYGXTNYMDOC-BJMVGYQFSA-N |
| XLogP | 0.85 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|