C18H21NO4 — CID 143741075
[(2E)-2-ethenylpenta-2,4-dienyl] 7-hydroxy-6-methoxy-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 143741075) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is [(2E)-2-ethenylpenta-2,4-dienyl] 7-hydroxy-6-methoxy-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | [(2E)-2-ethenylpenta-2,4-dienyl] 7-hydroxy-6-methoxy-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 143741075 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | [(2E)-2-ethenylpenta-2,4-dienyl] 7-hydroxy-6-methoxy-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | C=C/C=C(\C=C)COC(=O)N1CCc2cc(OC)c(O)cc2C1 |
| InChI | InChI=1S/C18H21NO4/c1-4-6-13(5-2)12-23-18(21)19-8-7-14-10-17(22-3)16(20)9-15(14)11-19/h4-6,9-10,20H,1-2,7-8,11-12H2,3H3/b13-6+ |
| InChIKey | HQPGUTRRQYUCQJ-AWNIVKPZSA-N |
| XLogP | 3.19 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|