C13H16N2O4 — CID 167465187
(3-methoxyphenyl)methyl 3-oxopiperazine-1-carboxylate (PubChem CID 167465187) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl 3-oxopiperazine-1-carboxylate.
| Compound Name | (3-methoxyphenyl)methyl 3-oxopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 167465187 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | (3-methoxyphenyl)methyl 3-oxopiperazine-1-carboxylate |
| SMILES | COc1cccc(COC(=O)N2CCNC(=O)C2)c1 |
| InChI | InChI=1S/C13H16N2O4/c1-18-11-4-2-3-10(7-11)9-19-13(17)15-6-5-14-12(16)8-15/h2-4,7H,5-6,8-9H2,1H3,(H,14,16) |
| InChIKey | RJAZWNFFWKNXOA-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |