C24H32N2O3S — CID 6734510
(3-methoxyphenyl)methyl 4-[(2-tert-butylsulfanylphenyl)methyl]piperazine-1-carboxylate (PubChem CID 6734510) has the molecular formula C24H32N2O3S and a molecular weight of 428.60 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl 4-[(2-tert-butylsulfanylphenyl)methyl]piperazine-1-carboxylate.
| Compound Name | (3-methoxyphenyl)methyl 4-[(2-tert-butylsulfanylphenyl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 6734510 |
| Molecular Formula | C24H32N2O3S |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | (3-methoxyphenyl)methyl 4-[(2-tert-butylsulfanylphenyl)methyl]piperazine-1-carboxylate |
| SMILES | COc1cccc(COC(=O)N2CCN(Cc3ccccc3SC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C24H32N2O3S/c1-24(2,3)30-22-11-6-5-9-20(22)17-25-12-14-26(15-13-25)23(27)29-18-19-8-7-10-21(16-19)28-4/h5-11,16H,12-15,17-18H2,1-4H3 |
| InChIKey | IHDIMQUBLUUAKN-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |