About chloromethyl 3-oxopiperazine-1-carboxylate
chloromethyl 3-oxopiperazine-1-carboxylate (PubChem CID 164660429) has the molecular formula C6H9ClN2O3
and a molecular weight of 192.60 g/mol. Its IUPAC name is chloromethyl 3-oxopiperazine-1-carboxylate.
Molecular Properties
| Compound Name | chloromethyl 3-oxopiperazine-1-carboxylate |
| PubChem CID | 164660429 |
| Molecular Formula | C6H9ClN2O3 |
| Molecular Weight | 192.60 g/mol |
| Exact Mass | 192.03 |
| IUPAC Name | chloromethyl 3-oxopiperazine-1-carboxylate |
| SMILES | O=C1CN(C(=O)OCCl)CCN1 |
| InChI | InChI=1S/C6H9ClN2O3/c7-4-12-6(11)9-2-1-8-5(10)3-9/h1-4H2,(H,8,10) |
| InChIKey | NFYHEEIERPZROE-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.60 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloromethyl 3-oxopiperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethyl 3-oxopiperazine-1-carboxylate?
The IUPAC name of chloromethyl 3-oxopiperazine-1-carboxylate (CID 164660429) is chloromethyl 3-oxopiperazine-1-carboxylate.
What is the SMILES notation for chloromethyl 3-oxopiperazine-1-carboxylate?
The canonical SMILES for chloromethyl 3-oxopiperazine-1-carboxylate is O=C1CN(C(=O)OCCl)CCN1.
What is the InChIKey of chloromethyl 3-oxopiperazine-1-carboxylate?
The InChIKey is NFYHEEIERPZROE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9ClN2O3/c7-4-12-6(11)9-2-1-8-5(10)3-9/h1-4H2,(H,8,10).
What are the key properties of chloromethyl 3-oxopiperazine-1-carboxylate?
chloromethyl 3-oxopiperazine-1-carboxylate has a molecular weight of 192.60 g/mol, XLogP of -0.25, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethyl 3-oxopiperazine-1-carboxylate is sourced from PubChem (CID 164660429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).