C15H27NO2 — CID 177159912
tert-butyl N-[(3Z)-3-ethenylhexa-3,5-dienyl]carbamate;ethane (PubChem CID 177159912) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is tert-butyl N-[(3Z)-3-ethenylhexa-3,5-dienyl]carbamate;ethane.
| Compound Name | tert-butyl N-[(3Z)-3-ethenylhexa-3,5-dienyl]carbamate;ethane |
|---|---|
| PubChem CID | 177159912 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | tert-butyl N-[(3Z)-3-ethenylhexa-3,5-dienyl]carbamate;ethane |
| SMILES | C=C/C=C(\C=C)CCNC(=O)OC(C)(C)C.CC |
| InChI | InChI=1S/C13H21NO2.C2H6/c1-6-8-11(7-2)9-10-14-12(15)16-13(3,4)5;1-2/h6-8H,1-2,9-10H2,3-5H3,(H,14,15);1-2H3/b11-8+; |
| InChIKey | COHNSLSAICVVMZ-YGCVIUNWSA-N |
| XLogP | 4.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|