C15H25NO4 — CID 156652796
tert-butyl N-[(4Z)-4-ethenylhepta-4,6-dien-2-yl]carbamate;formic acid (PubChem CID 156652796) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is tert-butyl N-[(4Z)-4-ethenylhepta-4,6-dien-2-yl]carbamate;formic acid.
| Compound Name | tert-butyl N-[(4Z)-4-ethenylhepta-4,6-dien-2-yl]carbamate;formic acid |
|---|---|
| PubChem CID | 156652796 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | tert-butyl N-[(4Z)-4-ethenylhepta-4,6-dien-2-yl]carbamate;formic acid |
| SMILES | C=C/C=C(\C=C)CC(C)NC(=O)OC(C)(C)C.O=CO |
| InChI | InChI=1S/C14H23NO2.CH2O2/c1-7-9-12(8-2)10-11(3)15-13(16)17-14(4,5)6;2-1-3/h7-9,11H,1-2,10H2,3-6H3,(H,15,16);1H,(H,2,3)/b12-9+; |
| InChIKey | DRFIUPVECDPGMN-NBYYMMLRSA-N |
| XLogP | 3.29 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|