tert-butyl N-[(4Z)-4-ethenylhepta-4,6-dien-2-yl]carbamate;formic acid

C15H25NO4 — CID 156652796

IUPACtert-butyl N-[(4Z)-4-ethenylhepta-4,6-dien-2-yl]carbamate;formic acid
SMILESC=C/C=C(\C=C)CC(C)NC(=O)OC(C)(C)C.O=CO
InChIInChI=1S/C14H23NO2.CH2O2/c1-7-9-12(8-2)10-11(3)15-13(16)17-14(4,5)6;2-1-3/h7-9,11H,1-2,10H2,3-6H3,(H,15,16);1H,(H,2,3)/b12-9+;
InChIKeyDRFIUPVECDPGMN-NBYYMMLRSA-N
MW283.37 g/mol
LogP3.29
Rot. Bonds5

About tert-butyl N-[(4Z)-4-ethenylhepta-4,6-dien-2-yl]carbamate;formic acid

tert-butyl N-[(4Z)-4-ethenylhepta-4,6-dien-2-yl]carbamate;formic acid (PubChem CID 156652796) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is tert-butyl N-[(4Z)-4-ethenylhepta-4,6-dien-2-yl]carbamate;formic acid.

Molecular Properties

Compound Nametert-butyl N-[(4Z)-4-ethenylhepta-4,6-dien-2-yl]carbamate;formic acid
PubChem CID156652796
Molecular FormulaC15H25NO4
Molecular Weight283.37 g/mol
Exact Mass283.18
IUPAC Nametert-butyl N-[(4Z)-4-ethenylhepta-4,6-dien-2-yl]carbamate;formic acid
SMILESC=C/C=C(\C=C)CC(C)NC(=O)OC(C)(C)C.O=CO
InChIInChI=1S/C14H23NO2.CH2O2/c1-7-9-12(8-2)10-11(3)15-13(16)17-14(4,5)6;2-1-3/h7-9,11H,1-2,10H2,3-6H3,(H,15,16);1H,(H,2,3)/b12-9+;
InChIKeyDRFIUPVECDPGMN-NBYYMMLRSA-N
XLogP3.29
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.37
LogP ≤ 53.29
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze tert-butyl N-[(4Z)-4-ethenylhepta-4,6-dien-2-yl]carbamate;formic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of tert-butyl N-[(4Z)-4-ethenylhepta-4,6-dien-2-yl]carbamate;formic acid?
The IUPAC name of tert-butyl N-[(4Z)-4-ethenylhepta-4,6-dien-2-yl]carbamate;formic acid (CID 156652796) is tert-butyl N-[(4Z)-4-ethenylhepta-4,6-dien-2-yl]carbamate;formic acid.
What is the SMILES notation for tert-butyl N-[(4Z)-4-ethenylhepta-4,6-dien-2-yl]carbamate;formic acid?
The canonical SMILES for tert-butyl N-[(4Z)-4-ethenylhepta-4,6-dien-2-yl]carbamate;formic acid is C=C/C=C(\C=C)CC(C)NC(=O)OC(C)(C)C.O=CO.
What is the InChIKey of tert-butyl N-[(4Z)-4-ethenylhepta-4,6-dien-2-yl]carbamate;formic acid?
The InChIKey is DRFIUPVECDPGMN-NBYYMMLRSA-N. The full InChI is InChI=1S/C14H23NO2.CH2O2/c1-7-9-12(8-2)10-11(3)15-13(16)17-14(4,5)6;2-1-3/h7-9,11H,1-2,10H2,3-6H3,(H,15,16);1H,(H,2,3)/b12-9+;.
What are the key properties of tert-butyl N-[(4Z)-4-ethenylhepta-4,6-dien-2-yl]carbamate;formic acid?
tert-butyl N-[(4Z)-4-ethenylhepta-4,6-dien-2-yl]carbamate;formic acid has a molecular weight of 283.37 g/mol, XLogP of 3.29, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(4Z)-4-ethenylhepta-4,6-dien-2-yl]carbamate;formic acid is sourced from PubChem (CID 156652796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).