C10H17ClN2OS — CID 71637010
5-(piperidin-4-ylmethoxymethyl)-1,3-thiazole;hydrochloride (PubChem CID 71637010) has the molecular formula C10H17ClN2OS and a molecular weight of 248.78 g/mol. Its IUPAC name is 5-(piperidin-4-ylmethoxymethyl)-1,3-thiazole;hydrochloride.
| Compound Name | 5-(piperidin-4-ylmethoxymethyl)-1,3-thiazole;hydrochloride |
|---|---|
| PubChem CID | 71637010 |
| Molecular Formula | C10H17ClN2OS |
| Molecular Weight | 248.78 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 5-(piperidin-4-ylmethoxymethyl)-1,3-thiazole;hydrochloride |
| SMILES | Cl.c1ncc(COCC2CCNCC2)s1 |
| InChI | InChI=1S/C10H16N2OS.ClH/c1-3-11-4-2-9(1)6-13-7-10-5-12-8-14-10;/h5,8-9,11H,1-4,6-7H2;1H |
| InChIKey | QLWUEPRWAICYEM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.78 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |