C7H12N2OS — CID 94578466
(2S)-2-(1,3-thiazol-5-ylmethylamino)propan-1-ol (PubChem CID 94578466) has the molecular formula C7H12N2OS and a molecular weight of 172.25 g/mol. Its IUPAC name is (2S)-2-(1,3-thiazol-5-ylmethylamino)propan-1-ol.
| Compound Name | (2S)-2-(1,3-thiazol-5-ylmethylamino)propan-1-ol |
|---|---|
| PubChem CID | 94578466 |
| Molecular Formula | C7H12N2OS |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | (2S)-2-(1,3-thiazol-5-ylmethylamino)propan-1-ol |
| SMILES | C[C@@H](CO)NCc1cncs1 |
| InChI | InChI=1S/C7H12N2OS/c1-6(4-10)9-3-7-2-8-5-11-7/h2,5-6,9-10H,3-4H2,1H3/t6-/m0/s1 |
| InChIKey | MAIPOWKYXJDUHH-LURJTMIESA-N |
| XLogP | 0.61 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |