C8H14N2OS — CID 103854616
(3R)-3-(1,3-thiazol-5-ylmethylamino)butan-1-ol (PubChem CID 103854616) has the molecular formula C8H14N2OS and a molecular weight of 186.28 g/mol. Its IUPAC name is (3R)-3-(1,3-thiazol-5-ylmethylamino)butan-1-ol.
| Compound Name | (3R)-3-(1,3-thiazol-5-ylmethylamino)butan-1-ol |
|---|---|
| PubChem CID | 103854616 |
| Molecular Formula | C8H14N2OS |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | (3R)-3-(1,3-thiazol-5-ylmethylamino)butan-1-ol |
| SMILES | C[C@H](CCO)NCc1cncs1 |
| InChI | InChI=1S/C8H14N2OS/c1-7(2-3-11)10-5-8-4-9-6-12-8/h4,6-7,10-11H,2-3,5H2,1H3/t7-/m1/s1 |
| InChIKey | MAOCKZXOVAJRIT-SSDOTTSWSA-N |
| XLogP | 1.00 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |