C8H14N2OS — CID 78997840
3-(1,3-thiazol-4-ylmethylamino)butan-1-ol (PubChem CID 78997840) has the molecular formula C8H14N2OS and a molecular weight of 186.28 g/mol. Its IUPAC name is 3-(1,3-thiazol-4-ylmethylamino)butan-1-ol.
| Compound Name | 3-(1,3-thiazol-4-ylmethylamino)butan-1-ol |
|---|---|
| PubChem CID | 78997840 |
| Molecular Formula | C8H14N2OS |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 3-(1,3-thiazol-4-ylmethylamino)butan-1-ol |
| SMILES | CC(CCO)NCc1cscn1 |
| InChI | InChI=1S/C8H14N2OS/c1-7(2-3-11)9-4-8-5-12-6-10-8/h5-7,9,11H,2-4H2,1H3 |
| InChIKey | FXWZLYKTVRTERC-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |