C9H12N2S — CID 115660275
N-(1,3-thiazol-4-ylmethyl)pent-4-yn-2-amine (PubChem CID 115660275) has the molecular formula C9H12N2S and a molecular weight of 180.28 g/mol. Its IUPAC name is N-(1,3-thiazol-4-ylmethyl)pent-4-yn-2-amine.
| Compound Name | N-(1,3-thiazol-4-ylmethyl)pent-4-yn-2-amine |
|---|---|
| PubChem CID | 115660275 |
| Molecular Formula | C9H12N2S |
| Molecular Weight | 180.28 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | N-(1,3-thiazol-4-ylmethyl)pent-4-yn-2-amine |
| SMILES | C#CCC(C)NCc1cscn1 |
| InChI | InChI=1S/C9H12N2S/c1-3-4-8(2)10-5-9-6-12-7-11-9/h1,6-8,10H,4-5H2,2H3 |
| InChIKey | MJTGCNRTXRUWQI-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|