C12H20N2S — CID 115715037
6-methyl-N-(1,3-thiazol-4-ylmethyl)hept-5-en-2-amine (PubChem CID 115715037) has the molecular formula C12H20N2S and a molecular weight of 224.37 g/mol. Its IUPAC name is 6-methyl-N-(1,3-thiazol-4-ylmethyl)hept-5-en-2-amine.
| Compound Name | 6-methyl-N-(1,3-thiazol-4-ylmethyl)hept-5-en-2-amine |
|---|---|
| PubChem CID | 115715037 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 6-methyl-N-(1,3-thiazol-4-ylmethyl)hept-5-en-2-amine |
| SMILES | CC(C)=CCCC(C)NCc1cscn1 |
| InChI | InChI=1S/C12H20N2S/c1-10(2)5-4-6-11(3)13-7-12-8-15-9-14-12/h5,8-9,11,13H,4,6-7H2,1-3H3 |
| InChIKey | WNBOPDAYHNWKTR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|