C9H14N2S — CID 60696131
1-cyclopropyl-N-(1,3-thiazol-4-ylmethyl)ethanamine (PubChem CID 60696131) has the molecular formula C9H14N2S and a molecular weight of 182.29 g/mol. Its IUPAC name is 1-cyclopropyl-N-(1,3-thiazol-4-ylmethyl)ethanamine.
| Compound Name | 1-cyclopropyl-N-(1,3-thiazol-4-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 60696131 |
| Molecular Formula | C9H14N2S |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 1-cyclopropyl-N-(1,3-thiazol-4-ylmethyl)ethanamine |
| SMILES | CC(NCc1cscn1)C1CC1 |
| InChI | InChI=1S/C9H14N2S/c1-7(8-2-3-8)10-4-9-5-12-6-11-9/h5-8,10H,2-4H2,1H3 |
| InChIKey | AFLVCUBFRKBNAG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |