C12H16N2 — CID 115699019
N-[(5-methyl-2-pyridinyl)methyl]pent-4-yn-2-amine (PubChem CID 115699019) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is N-[(5-methyl-2-pyridinyl)methyl]pent-4-yn-2-amine.
| Compound Name | N-[(5-methyl-2-pyridinyl)methyl]pent-4-yn-2-amine |
|---|---|
| PubChem CID | 115699019 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | N-[(5-methyl-2-pyridinyl)methyl]pent-4-yn-2-amine |
| SMILES | C#CCC(C)NCc1ccc(C)cn1 |
| InChI | InChI=1S/C12H16N2/c1-4-5-11(3)13-9-12-7-6-10(2)8-14-12/h1,6-8,11,13H,5,9H2,2-3H3 |
| InChIKey | XZUQFANBUXOLAP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|