C14H24N2 — CID 80708442
5-methyl-N-[(5-methyl-2-pyridinyl)methyl]hexan-2-amine (PubChem CID 80708442) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 5-methyl-N-[(5-methyl-2-pyridinyl)methyl]hexan-2-amine.
| Compound Name | 5-methyl-N-[(5-methyl-2-pyridinyl)methyl]hexan-2-amine |
|---|---|
| PubChem CID | 80708442 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 5-methyl-N-[(5-methyl-2-pyridinyl)methyl]hexan-2-amine |
| SMILES | Cc1ccc(CNC(C)CCC(C)C)nc1 |
| InChI | InChI=1S/C14H24N2/c1-11(2)5-7-13(4)15-10-14-8-6-12(3)9-16-14/h6,8-9,11,13,15H,5,7,10H2,1-4H3 |
| InChIKey | CKXCFTBAVUXHPD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |