C11H20N2OS — CID 111436912
3-[(2-propan-2-yl-1,3-thiazol-4-yl)methylamino]butan-1-ol (PubChem CID 111436912) has the molecular formula C11H20N2OS and a molecular weight of 228.36 g/mol. Its IUPAC name is 3-[(2-propan-2-yl-1,3-thiazol-4-yl)methylamino]butan-1-ol.
| Compound Name | 3-[(2-propan-2-yl-1,3-thiazol-4-yl)methylamino]butan-1-ol |
|---|---|
| PubChem CID | 111436912 |
| Molecular Formula | C11H20N2OS |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 3-[(2-propan-2-yl-1,3-thiazol-4-yl)methylamino]butan-1-ol |
| SMILES | CC(CCO)NCc1csc(C(C)C)n1 |
| InChI | InChI=1S/C11H20N2OS/c1-8(2)11-13-10(7-15-11)6-12-9(3)4-5-14/h7-9,12,14H,4-6H2,1-3H3 |
| InChIKey | DHVYLBWBXQWDNH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |