C10H18N2OS — CID 94578982
(2R)-4-methyl-2-(1,3-thiazol-5-ylmethylamino)pentan-1-ol (PubChem CID 94578982) has the molecular formula C10H18N2OS and a molecular weight of 214.33 g/mol. Its IUPAC name is (2R)-4-methyl-2-(1,3-thiazol-5-ylmethylamino)pentan-1-ol.
| Compound Name | (2R)-4-methyl-2-(1,3-thiazol-5-ylmethylamino)pentan-1-ol |
|---|---|
| PubChem CID | 94578982 |
| Molecular Formula | C10H18N2OS |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | (2R)-4-methyl-2-(1,3-thiazol-5-ylmethylamino)pentan-1-ol |
| SMILES | CC(C)C[C@H](CO)NCc1cncs1 |
| InChI | InChI=1S/C10H18N2OS/c1-8(2)3-9(6-13)12-5-10-4-11-7-14-10/h4,7-9,12-13H,3,5-6H2,1-2H3/t9-/m1/s1 |
| InChIKey | LSJBADKATIADFH-SECBINFHSA-N |
| XLogP | 1.64 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |