C19H28O — CID 65395381
2-(2,3-dihydro-1H-inden-5-yl)-1-(4-ethylcyclohexyl)ethanol (PubChem CID 65395381) has the molecular formula C19H28O and a molecular weight of 272.43 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-5-yl)-1-(4-ethylcyclohexyl)ethanol.
| Compound Name | 2-(2,3-dihydro-1H-inden-5-yl)-1-(4-ethylcyclohexyl)ethanol |
|---|---|
| PubChem CID | 65395381 |
| Molecular Formula | C19H28O |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-5-yl)-1-(4-ethylcyclohexyl)ethanol |
| SMILES | CCC1CCC(C(O)Cc2ccc3c(c2)CCC3)CC1 |
| InChI | InChI=1S/C19H28O/c1-2-14-6-10-17(11-7-14)19(20)13-15-8-9-16-4-3-5-18(16)12-15/h8-9,12,14,17,19-20H,2-7,10-11,13H2,1H3 |
| InChIKey | YNCULQRVNDXLRI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |