C13H12O2S2 — CID 106600947
2,3-dihydro-1,4-benzoxathiin-2-yl(thiophen-2-yl)methanol (PubChem CID 106600947) has the molecular formula C13H12O2S2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzoxathiin-2-yl(thiophen-2-yl)methanol.
| Compound Name | 2,3-dihydro-1,4-benzoxathiin-2-yl(thiophen-2-yl)methanol |
|---|---|
| PubChem CID | 106600947 |
| Molecular Formula | C13H12O2S2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 2,3-dihydro-1,4-benzoxathiin-2-yl(thiophen-2-yl)methanol |
| SMILES | OC(c1cccs1)C1CSc2ccccc2O1 |
| InChI | InChI=1S/C13H12O2S2/c14-13(12-6-3-7-16-12)10-8-17-11-5-2-1-4-9(11)15-10/h1-7,10,13-14H,8H2 |
| InChIKey | XDGZCBVSNMBUFZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |