C16H16O3S — CID 106600926
2,3-dihydro-1,4-benzoxathiin-2-yl-(3-methoxyphenyl)methanol (PubChem CID 106600926) has the molecular formula C16H16O3S and a molecular weight of 288.37 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzoxathiin-2-yl-(3-methoxyphenyl)methanol.
| Compound Name | 2,3-dihydro-1,4-benzoxathiin-2-yl-(3-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 106600926 |
| Molecular Formula | C16H16O3S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 2,3-dihydro-1,4-benzoxathiin-2-yl-(3-methoxyphenyl)methanol |
| SMILES | COc1cccc(C(O)C2CSc3ccccc3O2)c1 |
| InChI | InChI=1S/C16H16O3S/c1-18-12-6-4-5-11(9-12)16(17)14-10-20-15-8-3-2-7-13(15)19-14/h2-9,14,16-17H,10H2,1H3 |
| InChIKey | ATUMYCFRKWXLEF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |