C12H16O2S2 — CID 79972446
1,4-dithian-2-yl-(3-methoxyphenyl)methanol (PubChem CID 79972446) has the molecular formula C12H16O2S2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 1,4-dithian-2-yl-(3-methoxyphenyl)methanol.
| Compound Name | 1,4-dithian-2-yl-(3-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 79972446 |
| Molecular Formula | C12H16O2S2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 1,4-dithian-2-yl-(3-methoxyphenyl)methanol |
| SMILES | COc1cccc(C(O)C2CSCCS2)c1 |
| InChI | InChI=1S/C12H16O2S2/c1-14-10-4-2-3-9(7-10)12(13)11-8-15-5-6-16-11/h2-4,7,11-13H,5-6,8H2,1H3 |
| InChIKey | NPISOFFICPXYOD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |