C11H12F2OS2 — CID 79973241
(2,3-difluorophenyl)-(1,4-dithian-2-yl)methanol (PubChem CID 79973241) has the molecular formula C11H12F2OS2 and a molecular weight of 262.35 g/mol. Its IUPAC name is (2,3-difluorophenyl)-(1,4-dithian-2-yl)methanol.
| Compound Name | (2,3-difluorophenyl)-(1,4-dithian-2-yl)methanol |
|---|---|
| PubChem CID | 79973241 |
| Molecular Formula | C11H12F2OS2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | (2,3-difluorophenyl)-(1,4-dithian-2-yl)methanol |
| SMILES | OC(c1cccc(F)c1F)C1CSCCS1 |
| InChI | InChI=1S/C11H12F2OS2/c12-8-3-1-2-7(10(8)13)11(14)9-6-15-4-5-16-9/h1-3,9,11,14H,4-6H2 |
| InChIKey | UEJCKSZZFLXTIC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |