C12H14BrFOS2 — CID 79971539
2-(2-bromo-4-fluorophenyl)-1-(1,4-dithian-2-yl)ethanol (PubChem CID 79971539) has the molecular formula C12H14BrFOS2 and a molecular weight of 337.28 g/mol. Its IUPAC name is 2-(2-bromo-4-fluorophenyl)-1-(1,4-dithian-2-yl)ethanol.
| Compound Name | 2-(2-bromo-4-fluorophenyl)-1-(1,4-dithian-2-yl)ethanol |
|---|---|
| PubChem CID | 79971539 |
| Molecular Formula | C12H14BrFOS2 |
| Molecular Weight | 337.28 g/mol |
| Exact Mass | 335.97 |
| IUPAC Name | 2-(2-bromo-4-fluorophenyl)-1-(1,4-dithian-2-yl)ethanol |
| SMILES | OC(Cc1ccc(F)cc1Br)C1CSCCS1 |
| InChI | InChI=1S/C12H14BrFOS2/c13-10-6-9(14)2-1-8(10)5-11(15)12-7-16-3-4-17-12/h1-2,6,11-12,15H,3-5,7H2 |
| InChIKey | RSICNLOFVRXUFV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.28 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |