C15H21BrFNS — CID 105136332
1-(2-bromo-4-fluorophenyl)-N-methyl-3-(thian-4-yl)propan-2-amine (PubChem CID 105136332) has the molecular formula C15H21BrFNS and a molecular weight of 346.31 g/mol. Its IUPAC name is 1-(2-bromo-4-fluorophenyl)-N-methyl-3-(thian-4-yl)propan-2-amine.
| Compound Name | 1-(2-bromo-4-fluorophenyl)-N-methyl-3-(thian-4-yl)propan-2-amine |
|---|---|
| PubChem CID | 105136332 |
| Molecular Formula | C15H21BrFNS |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | 1-(2-bromo-4-fluorophenyl)-N-methyl-3-(thian-4-yl)propan-2-amine |
| SMILES | CNC(Cc1ccc(F)cc1Br)CC1CCSCC1 |
| InChI | InChI=1S/C15H21BrFNS/c1-18-14(8-11-4-6-19-7-5-11)9-12-2-3-13(17)10-15(12)16/h2-3,10-11,14,18H,4-9H2,1H3 |
| InChIKey | IFQOOORAXHGLHW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |