C15H20BrF2NS — CID 106274149
1-(3-bromo-2,6-difluorophenyl)-N-methyl-3-(thian-4-yl)propan-2-amine (PubChem CID 106274149) has the molecular formula C15H20BrF2NS and a molecular weight of 364.30 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-N-methyl-3-(thian-4-yl)propan-2-amine.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-N-methyl-3-(thian-4-yl)propan-2-amine |
|---|---|
| PubChem CID | 106274149 |
| Molecular Formula | C15H20BrF2NS |
| Molecular Weight | 364.30 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-N-methyl-3-(thian-4-yl)propan-2-amine |
| SMILES | CNC(Cc1c(F)ccc(Br)c1F)CC1CCSCC1 |
| InChI | InChI=1S/C15H20BrF2NS/c1-19-11(8-10-4-6-20-7-5-10)9-12-14(17)3-2-13(16)15(12)18/h2-3,10-11,19H,4-9H2,1H3 |
| InChIKey | AJTRHVZGAUDGCB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.30 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|