C14H19BrFN — CID 103168480
1-(2-bromo-5-fluorophenyl)-3-cyclobutyl-N-methylpropan-2-amine (PubChem CID 103168480) has the molecular formula C14H19BrFN and a molecular weight of 300.21 g/mol. Its IUPAC name is 1-(2-bromo-5-fluorophenyl)-3-cyclobutyl-N-methylpropan-2-amine.
| Compound Name | 1-(2-bromo-5-fluorophenyl)-3-cyclobutyl-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 103168480 |
| Molecular Formula | C14H19BrFN |
| Molecular Weight | 300.21 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 1-(2-bromo-5-fluorophenyl)-3-cyclobutyl-N-methylpropan-2-amine |
| SMILES | CNC(Cc1cc(F)ccc1Br)CC1CCC1 |
| InChI | InChI=1S/C14H19BrFN/c1-17-13(7-10-3-2-4-10)9-11-8-12(16)5-6-14(11)15/h5-6,8,10,13,17H,2-4,7,9H2,1H3 |
| InChIKey | XCKSJRSKBYATCP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.21 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |