C16H16Br2FN — CID 63412893
1-(2-bromo-5-fluorophenyl)-3-(4-bromophenyl)-N-methylpropan-2-amine (PubChem CID 63412893) has the molecular formula C16H16Br2FN and a molecular weight of 401.12 g/mol. Its IUPAC name is 1-(2-bromo-5-fluorophenyl)-3-(4-bromophenyl)-N-methylpropan-2-amine.
| Compound Name | 1-(2-bromo-5-fluorophenyl)-3-(4-bromophenyl)-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 63412893 |
| Molecular Formula | C16H16Br2FN |
| Molecular Weight | 401.12 g/mol |
| Exact Mass | 398.96 |
| IUPAC Name | 1-(2-bromo-5-fluorophenyl)-3-(4-bromophenyl)-N-methylpropan-2-amine |
| SMILES | CNC(Cc1ccc(Br)cc1)Cc1cc(F)ccc1Br |
| InChI | InChI=1S/C16H16Br2FN/c1-20-15(8-11-2-4-13(17)5-3-11)10-12-9-14(19)6-7-16(12)18/h2-7,9,15,20H,8,10H2,1H3 |
| InChIKey | YNONUSNSHMYOKN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.12 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |